C16H18 — CID 141269354
5-ethyl-1,2,3,4-tetrahydroanthracene (PubChem CID 141269354) has the molecular formula C16H18 and a molecular weight of 210.32 g/mol. Its IUPAC name is 5-ethyl-1,2,3,4-tetrahydroanthracene.
| Compound Name | 5-ethyl-1,2,3,4-tetrahydroanthracene |
|---|---|
| PubChem CID | 141269354 |
| Molecular Formula | C16H18 |
| Molecular Weight | 210.32 g/mol |
| Exact Mass | 210.14 |
| IUPAC Name | 5-ethyl-1,2,3,4-tetrahydroanthracene |
| SMILES | CCc1cccc2cc3c(cc12)CCCC3 |
| InChI | InChI=1S/C16H18/c1-2-12-8-5-9-15-10-13-6-3-4-7-14(13)11-16(12)15/h5,8-11H,2-4,6-7H2,1H3 |
| InChIKey | VYQDECJRVXMGBN-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.32 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |