About 1-propylinden-1-ide
1-propylinden-1-ide (PubChem CID 135030487) has the molecular formula C12H13-
and a molecular weight of 157.24 g/mol. Its IUPAC name is 1-propylinden-1-ide.
Molecular Properties
| Compound Name | 1-propylinden-1-ide |
| PubChem CID | 135030487 |
| Molecular Formula | C12H13- |
| Molecular Weight | 157.24 g/mol |
| Exact Mass | 157.10 |
| IUPAC Name | 1-propylinden-1-ide |
| SMILES | CCC[c-]1ccc2ccccc21 |
| InChI | InChI=1S/C12H13/c1-2-5-10-8-9-11-6-3-4-7-12(10)11/h3-4,6-9H,2,5H2,1H3/q-1 |
| InChIKey | IESRBLRFCIFCJM-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 157.24 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 1-propylinden-1-ide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-propylinden-1-ide?
The IUPAC name of 1-propylinden-1-ide (CID 135030487) is 1-propylinden-1-ide.
What is the SMILES notation for 1-propylinden-1-ide?
The canonical SMILES for 1-propylinden-1-ide is CCC[c-]1ccc2ccccc21.
What is the InChIKey of 1-propylinden-1-ide?
The InChIKey is IESRBLRFCIFCJM-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13/c1-2-5-10-8-9-11-6-3-4-7-12(10)11/h3-4,6-9H,2,5H2,1H3/q-1.
What are the key properties of 1-propylinden-1-ide?
1-propylinden-1-ide has a molecular weight of 157.24 g/mol, XLogP of 3.51, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-propylinden-1-ide is sourced from PubChem (CID 135030487), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).