About 1-benzylinden-1-ide;hafnium;dihydrochloride
1-benzylinden-1-ide;hafnium;dihydrochloride (PubChem CID 174711380) has the molecular formula C16H15Cl2Hf-
and a molecular weight of 456.69 g/mol. Its IUPAC name is 1-benzylinden-1-ide;hafnium;dihydrochloride.
Molecular Properties
| Compound Name | 1-benzylinden-1-ide;hafnium;dihydrochloride |
| PubChem CID | 174711380 |
| Molecular Formula | C16H15Cl2Hf- |
| Molecular Weight | 456.69 g/mol |
| Exact Mass | 457.00 |
| IUPAC Name | 1-benzylinden-1-ide;hafnium;dihydrochloride |
| SMILES | Cl.Cl.[Hf].c1ccc(C[c-]2ccc3ccccc32)cc1 |
| InChI | InChI=1S/C16H13.2ClH.Hf/c1-2-6-13(7-3-1)12-15-11-10-14-8-4-5-9-16(14)15;;;/h1-11H,12H2;2*1H;/q-1;;; |
| InChIKey | QZOPTIKPYLCFHP-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 456.69 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 1-benzylinden-1-ide;hafnium;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-benzylinden-1-ide;hafnium;dihydrochloride?
The IUPAC name of 1-benzylinden-1-ide;hafnium;dihydrochloride (CID 174711380) is 1-benzylinden-1-ide;hafnium;dihydrochloride.
What is the SMILES notation for 1-benzylinden-1-ide;hafnium;dihydrochloride?
The canonical SMILES for 1-benzylinden-1-ide;hafnium;dihydrochloride is Cl.Cl.[Hf].c1ccc(C[c-]2ccc3ccccc32)cc1.
What is the InChIKey of 1-benzylinden-1-ide;hafnium;dihydrochloride?
The InChIKey is QZOPTIKPYLCFHP-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H13.2ClH.Hf/c1-2-6-13(7-3-1)12-15-11-10-14-8-4-5-9-16(14)15;;;/h1-11H,12H2;2*1H;/q-1;;;.
What are the key properties of 1-benzylinden-1-ide;hafnium;dihydrochloride?
1-benzylinden-1-ide;hafnium;dihydrochloride has a molecular weight of 456.69 g/mol, XLogP of 4.99, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-benzylinden-1-ide;hafnium;dihydrochloride is sourced from PubChem (CID 174711380), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).