About 3-benzylcyclopenta[b]naphthalen-3-ide;carbanide;hafnium
3-benzylcyclopenta[b]naphthalen-3-ide;carbanide;hafnium (PubChem CID 175248619) has the molecular formula C22H21Hf-3
and a molecular weight of 463.90 g/mol. Its IUPAC name is 3-benzylcyclopenta[b]naphthalen-3-ide;carbanide;hafnium.
Molecular Properties
| Compound Name | 3-benzylcyclopenta[b]naphthalen-3-ide;carbanide;hafnium |
| PubChem CID | 175248619 |
| Molecular Formula | C22H21Hf-3 |
| Molecular Weight | 463.90 g/mol |
| Exact Mass | 465.11 |
| IUPAC Name | 3-benzylcyclopenta[b]naphthalen-3-ide;carbanide;hafnium |
| SMILES | [CH3-].[CH3-].[Hf].c1ccc(C[c-]2ccc3cc4ccccc4cc32)cc1 |
| InChI | InChI=1S/C20H15.2CH3.Hf/c1-2-6-15(7-3-1)12-18-10-11-19-13-16-8-4-5-9-17(16)14-20(18)19;;;/h1-11,13-14H,12H2;2*1H3;/q3*-1; |
| InChIKey | COZZOQDVRWMHPS-UHFFFAOYSA-N |
| XLogP | 6.20 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 463.90 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 3-benzylcyclopenta[b]naphthalen-3-ide;carbanide;hafnium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-benzylcyclopenta[b]naphthalen-3-ide;carbanide;hafnium?
The IUPAC name of 3-benzylcyclopenta[b]naphthalen-3-ide;carbanide;hafnium (CID 175248619) is 3-benzylcyclopenta[b]naphthalen-3-ide;carbanide;hafnium.
What is the SMILES notation for 3-benzylcyclopenta[b]naphthalen-3-ide;carbanide;hafnium?
The canonical SMILES for 3-benzylcyclopenta[b]naphthalen-3-ide;carbanide;hafnium is [CH3-].[CH3-].[Hf].c1ccc(C[c-]2ccc3cc4ccccc4cc32)cc1.
What is the InChIKey of 3-benzylcyclopenta[b]naphthalen-3-ide;carbanide;hafnium?
The InChIKey is COZZOQDVRWMHPS-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H15.2CH3.Hf/c1-2-6-15(7-3-1)12-18-10-11-19-13-16-8-4-5-9-17(16)14-20(18)19;;;/h1-11,13-14H,12H2;2*1H3;/q3*-1;.
What are the key properties of 3-benzylcyclopenta[b]naphthalen-3-ide;carbanide;hafnium?
3-benzylcyclopenta[b]naphthalen-3-ide;carbanide;hafnium has a molecular weight of 463.90 g/mol, XLogP of 6.20, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 3-benzylcyclopenta[b]naphthalen-3-ide;carbanide;hafnium is sourced from PubChem (CID 175248619), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).