About 1-phenylinden-1-ide;zirconium;dihydroiodide
1-phenylinden-1-ide;zirconium;dihydroiodide (PubChem CID 174711483) has the molecular formula C15H13I2Zr-
and a molecular weight of 538.30 g/mol. Its IUPAC name is 1-phenylinden-1-ide;zirconium;dihydroiodide.
Molecular Properties
| Compound Name | 1-phenylinden-1-ide;zirconium;dihydroiodide |
| PubChem CID | 174711483 |
| Molecular Formula | C15H13I2Zr- |
| Molecular Weight | 538.30 g/mol |
| Exact Mass | 536.82 |
| IUPAC Name | 1-phenylinden-1-ide;zirconium;dihydroiodide |
| SMILES | I.I.[Zr].c1ccc(-[c-]2ccc3ccccc32)cc1 |
| InChI | InChI=1S/C15H11.2HI.Zr/c1-2-6-12(7-3-1)15-11-10-13-8-4-5-9-14(13)15;;;/h1-11H;2*1H;/q-1;;; |
| InChIKey | MHMHEXXGTHHMNG-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 538.30 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 1-phenylinden-1-ide;zirconium;dihydroiodide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-phenylinden-1-ide;zirconium;dihydroiodide?
The IUPAC name of 1-phenylinden-1-ide;zirconium;dihydroiodide (CID 174711483) is 1-phenylinden-1-ide;zirconium;dihydroiodide.
What is the SMILES notation for 1-phenylinden-1-ide;zirconium;dihydroiodide?
The canonical SMILES for 1-phenylinden-1-ide;zirconium;dihydroiodide is I.I.[Zr].c1ccc(-[c-]2ccc3ccccc32)cc1.
What is the InChIKey of 1-phenylinden-1-ide;zirconium;dihydroiodide?
The InChIKey is MHMHEXXGTHHMNG-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H11.2HI.Zr/c1-2-6-12(7-3-1)15-11-10-13-8-4-5-9-14(13)15;;;/h1-11H;2*1H;/q-1;;;.
What are the key properties of 1-phenylinden-1-ide;zirconium;dihydroiodide?
1-phenylinden-1-ide;zirconium;dihydroiodide has a molecular weight of 538.30 g/mol, XLogP of 5.46, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-phenylinden-1-ide;zirconium;dihydroiodide is sourced from PubChem (CID 174711483), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).