About 1-inden-1-id-1-ylpyrrole;zirconium;dihydrochloride
1-inden-1-id-1-ylpyrrole;zirconium;dihydrochloride (PubChem CID 87862862) has the molecular formula C13H12Cl2NZr-
and a molecular weight of 344.38 g/mol. Its IUPAC name is 1-inden-1-id-1-ylpyrrole;zirconium;dihydrochloride.
Molecular Properties
| Compound Name | 1-inden-1-id-1-ylpyrrole;zirconium;dihydrochloride |
| PubChem CID | 87862862 |
| Molecular Formula | C13H12Cl2NZr- |
| Molecular Weight | 344.38 g/mol |
| Exact Mass | 341.94 |
| IUPAC Name | 1-inden-1-id-1-ylpyrrole;zirconium;dihydrochloride |
| SMILES | Cl.Cl.[Zr].c1ccc2c(c1)cc[c-]2-n1cccc1 |
| InChI | InChI=1S/C13H10N.2ClH.Zr/c1-2-6-12-11(5-1)7-8-13(12)14-9-3-4-10-14;;;/h1-10H;2*1H;/q-1;;; |
| InChIKey | XLNLIOSBTVDHAK-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 344.38 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 1-inden-1-id-1-ylpyrrole;zirconium;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-inden-1-id-1-ylpyrrole;zirconium;dihydrochloride?
The IUPAC name of 1-inden-1-id-1-ylpyrrole;zirconium;dihydrochloride (CID 87862862) is 1-inden-1-id-1-ylpyrrole;zirconium;dihydrochloride.
What is the SMILES notation for 1-inden-1-id-1-ylpyrrole;zirconium;dihydrochloride?
The canonical SMILES for 1-inden-1-id-1-ylpyrrole;zirconium;dihydrochloride is Cl.Cl.[Zr].c1ccc2c(c1)cc[c-]2-n1cccc1.
What is the InChIKey of 1-inden-1-id-1-ylpyrrole;zirconium;dihydrochloride?
The InChIKey is XLNLIOSBTVDHAK-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H10N.2ClH.Zr/c1-2-6-12-11(5-1)7-8-13(12)14-9-3-4-10-14;;;/h1-10H;2*1H;/q-1;;;.
What are the key properties of 1-inden-1-id-1-ylpyrrole;zirconium;dihydrochloride?
1-inden-1-id-1-ylpyrrole;zirconium;dihydrochloride has a molecular weight of 344.38 g/mol, XLogP of 4.19, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-inden-1-id-1-ylpyrrole;zirconium;dihydrochloride is sourced from PubChem (CID 87862862), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).