About 1-methyl-9H-indeno[2,1-b]pyridin-1-ium iodide
1-methyl-9H-indeno[2,1-b]pyridin-1-ium iodide (PubChem CID 3054372) has the molecular formula C13H12IN
and a molecular weight of 309.15 g/mol. Its IUPAC name is 1-methyl-9H-indeno[2,1-b]pyridin-1-ium iodide.
Molecular Properties
| Compound Name | 1-methyl-9H-indeno[2,1-b]pyridin-1-ium iodide |
| PubChem CID | 3054372 |
| Molecular Formula | C13H12IN |
| Molecular Weight | 309.15 g/mol |
| Exact Mass | 309.00 |
| IUPAC Name | 1-methyl-9H-indeno[2,1-b]pyridin-1-ium iodide |
| SMILES | C[n+]1cccc2c1Cc1ccccc1-2.[I-] |
| InChI | InChI=1S/C13H12N.HI/c1-14-8-4-7-12-11-6-3-2-5-10(11)9-13(12)14;/h2-8H,9H2,1H3;1H/q+1;/p-1 |
| InChIKey | GIDQNYIGYNLVBX-UHFFFAOYSA-M |
| XLogP | -0.91 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 309.15 |
| LogP ≤ 5 | -0.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 1-methyl-9H-indeno[2,1-b]pyridin-1-ium iodide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-9H-indeno[2,1-b]pyridin-1-ium iodide?
The IUPAC name of 1-methyl-9H-indeno[2,1-b]pyridin-1-ium iodide (CID 3054372) is 1-methyl-9H-indeno[2,1-b]pyridin-1-ium iodide.
What is the SMILES notation for 1-methyl-9H-indeno[2,1-b]pyridin-1-ium iodide?
The canonical SMILES for 1-methyl-9H-indeno[2,1-b]pyridin-1-ium iodide is C[n+]1cccc2c1Cc1ccccc1-2.[I-].
What is the InChIKey of 1-methyl-9H-indeno[2,1-b]pyridin-1-ium iodide?
The InChIKey is GIDQNYIGYNLVBX-UHFFFAOYSA-M. The full InChI is InChI=1S/C13H12N.HI/c1-14-8-4-7-12-11-6-3-2-5-10(11)9-13(12)14;/h2-8H,9H2,1H3;1H/q+1;/p-1.
What are the key properties of 1-methyl-9H-indeno[2,1-b]pyridin-1-ium iodide?
1-methyl-9H-indeno[2,1-b]pyridin-1-ium iodide has a molecular weight of 309.15 g/mol, XLogP of -0.91, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-9H-indeno[2,1-b]pyridin-1-ium iodide is sourced from PubChem (CID 3054372), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).