About sodium 1-methylinden-1-ide
sodium 1-methylinden-1-ide (PubChem CID 175318654) has the molecular formula C10H9Na
and a molecular weight of 152.17 g/mol. Its IUPAC name is sodium 1-methylinden-1-ide.
Molecular Properties
| Compound Name | sodium 1-methylinden-1-ide |
| PubChem CID | 175318654 |
| Molecular Formula | C10H9Na |
| Molecular Weight | 152.17 g/mol |
| Exact Mass | 152.06 |
| IUPAC Name | sodium 1-methylinden-1-ide |
| SMILES | C[c-]1ccc2ccccc21.[Na+] |
| InChI | InChI=1S/C10H9.Na/c1-8-6-7-9-4-2-3-5-10(8)9;/h2-7H,1H3;/q-1;+1 |
| InChIKey | DWTGBTZNBDCCPX-UHFFFAOYSA-N |
| XLogP | -0.13 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 152.17 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze sodium 1-methylinden-1-ide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium 1-methylinden-1-ide?
The IUPAC name of sodium 1-methylinden-1-ide (CID 175318654) is sodium 1-methylinden-1-ide.
What is the SMILES notation for sodium 1-methylinden-1-ide?
The canonical SMILES for sodium 1-methylinden-1-ide is C[c-]1ccc2ccccc21.[Na+].
What is the InChIKey of sodium 1-methylinden-1-ide?
The InChIKey is DWTGBTZNBDCCPX-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9.Na/c1-8-6-7-9-4-2-3-5-10(8)9;/h2-7H,1H3;/q-1;+1.
What are the key properties of sodium 1-methylinden-1-ide?
sodium 1-methylinden-1-ide has a molecular weight of 152.17 g/mol, XLogP of -0.13, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for sodium 1-methylinden-1-ide is sourced from PubChem (CID 175318654), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).