About carbanide;hafnium;1-methylcyclopenta[a]naphthalen-1-ide
carbanide;hafnium;1-methylcyclopenta[a]naphthalen-1-ide (PubChem CID 175248588) has the molecular formula C16H17Hf-3
and a molecular weight of 387.80 g/mol. Its IUPAC name is carbanide;hafnium;1-methylcyclopenta[a]naphthalen-1-ide.
Molecular Properties
| Compound Name | carbanide;hafnium;1-methylcyclopenta[a]naphthalen-1-ide |
| PubChem CID | 175248588 |
| Molecular Formula | C16H17Hf-3 |
| Molecular Weight | 387.80 g/mol |
| Exact Mass | 389.08 |
| IUPAC Name | carbanide;hafnium;1-methylcyclopenta[a]naphthalen-1-ide |
| SMILES | C[c-]1ccc2ccc3ccccc3c21.[CH3-].[CH3-].[Hf] |
| InChI | InChI=1S/C14H11.2CH3.Hf/c1-10-6-7-12-9-8-11-4-2-3-5-13(11)14(10)12;;;/h2-9H,1H3;2*1H3;/q3*-1; |
| InChIKey | IGYNAHABVKUVON-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 387.80 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze carbanide;hafnium;1-methylcyclopenta[a]naphthalen-1-ide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of carbanide;hafnium;1-methylcyclopenta[a]naphthalen-1-ide?
The IUPAC name of carbanide;hafnium;1-methylcyclopenta[a]naphthalen-1-ide (CID 175248588) is carbanide;hafnium;1-methylcyclopenta[a]naphthalen-1-ide.
What is the SMILES notation for carbanide;hafnium;1-methylcyclopenta[a]naphthalen-1-ide?
The canonical SMILES for carbanide;hafnium;1-methylcyclopenta[a]naphthalen-1-ide is C[c-]1ccc2ccc3ccccc3c21.[CH3-].[CH3-].[Hf].
What is the InChIKey of carbanide;hafnium;1-methylcyclopenta[a]naphthalen-1-ide?
The InChIKey is IGYNAHABVKUVON-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H11.2CH3.Hf/c1-10-6-7-12-9-8-11-4-2-3-5-13(11)14(10)12;;;/h2-9H,1H3;2*1H3;/q3*-1;.
What are the key properties of carbanide;hafnium;1-methylcyclopenta[a]naphthalen-1-ide?
carbanide;hafnium;1-methylcyclopenta[a]naphthalen-1-ide has a molecular weight of 387.80 g/mol, XLogP of 4.92, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for carbanide;hafnium;1-methylcyclopenta[a]naphthalen-1-ide is sourced from PubChem (CID 175248588), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).