About cyclopenta-1,3-diene;phenanthrene
cyclopenta-1,3-diene;phenanthrene (PubChem CID 159923928) has the molecular formula C19H16
and a molecular weight of 244.34 g/mol. Its IUPAC name is cyclopenta-1,3-diene;phenanthrene.
Molecular Properties
| Compound Name | cyclopenta-1,3-diene;phenanthrene |
| PubChem CID | 159923928 |
| Molecular Formula | C19H16 |
| Molecular Weight | 244.34 g/mol |
| Exact Mass | 244.13 |
| IUPAC Name | cyclopenta-1,3-diene;phenanthrene |
| SMILES | C1=CCC=C1.c1ccc2c(c1)ccc1ccccc12 |
| InChI | InChI=1S/C14H10.C5H6/c1-3-7-13-11(5-1)9-10-12-6-2-4-8-14(12)13;1-2-4-5-3-1/h1-10H;1-4H,5H2 |
| InChIKey | NYTOPFFXYIZCDN-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 244.34 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze cyclopenta-1,3-diene;phenanthrene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclopenta-1,3-diene;phenanthrene?
The IUPAC name of cyclopenta-1,3-diene;phenanthrene (CID 159923928) is cyclopenta-1,3-diene;phenanthrene.
What is the SMILES notation for cyclopenta-1,3-diene;phenanthrene?
The canonical SMILES for cyclopenta-1,3-diene;phenanthrene is C1=CCC=C1.c1ccc2c(c1)ccc1ccccc12.
What is the InChIKey of cyclopenta-1,3-diene;phenanthrene?
The InChIKey is NYTOPFFXYIZCDN-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H10.C5H6/c1-3-7-13-11(5-1)9-10-12-6-2-4-8-14(12)13;1-2-4-5-3-1/h1-10H;1-4H,5H2.
What are the key properties of cyclopenta-1,3-diene;phenanthrene?
cyclopenta-1,3-diene;phenanthrene has a molecular weight of 244.34 g/mol, XLogP of 5.50, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for cyclopenta-1,3-diene;phenanthrene is sourced from PubChem (CID 159923928), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).