C18H26V-6 — CID 173190648
5-butylcyclopenta-1,3-diene;butylcyclopentane;vanadium (PubChem CID 173190648) has the molecular formula C18H26V-6 and a molecular weight of 293.35 g/mol. Its IUPAC name is 5-butylcyclopenta-1,3-diene;butylcyclopentane;vanadium.
| Compound Name | 5-butylcyclopenta-1,3-diene;butylcyclopentane;vanadium |
|---|---|
| PubChem CID | 173190648 |
| Molecular Formula | C18H26V-6 |
| Molecular Weight | 293.35 g/mol |
| Exact Mass | 293.15 |
| IUPAC Name | 5-butylcyclopenta-1,3-diene;butylcyclopentane;vanadium |
| SMILES | CCCC[c-]1[cH-][cH-][cH-][cH-]1.CCCC[c-]1cccc1.[V] |
| InChI | InChI=1S/2C9H13.V/c2*1-2-3-6-9-7-4-5-8-9;/h2*4-5,7-8H,2-3,6H2,1H3;/q-5;-1; |
| InChIKey | NLRPMEOXFRYLAW-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.35 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|