About tris(dimethylazanide);hafnium(4+);5-(2-methylpropyl)cyclopenta-1,3-diene
tris(dimethylazanide);hafnium(4+);5-(2-methylpropyl)cyclopenta-1,3-diene (PubChem CID 155667440) has the molecular formula C15H31HfN3
and a molecular weight of 431.92 g/mol. Its IUPAC name is tris(dimethylazanide);hafnium(4+);5-(2-methylpropyl)cyclopenta-1,3-diene.
Molecular Properties
| Compound Name | tris(dimethylazanide);hafnium(4+);5-(2-methylpropyl)cyclopenta-1,3-diene |
| PubChem CID | 155667440 |
| Molecular Formula | C15H31HfN3 |
| Molecular Weight | 431.92 g/mol |
| Exact Mass | 433.20 |
| IUPAC Name | tris(dimethylazanide);hafnium(4+);5-(2-methylpropyl)cyclopenta-1,3-diene |
| SMILES | CC(C)C[c-]1cccc1.C[N-]C.C[N-]C.C[N-]C.[Hf+4] |
| InChI | InChI=1S/C9H13.3C2H6N.Hf/c1-8(2)7-9-5-3-4-6-9;3*1-3-2;/h3-6,8H,7H2,1-2H3;3*1-2H3;/q4*-1;+4 |
| InChIKey | FGEISUFAJQWKNE-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 42.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 431.92 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze tris(dimethylazanide);hafnium(4+);5-(2-methylpropyl)cyclopenta-1,3-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tris(dimethylazanide);hafnium(4+);5-(2-methylpropyl)cyclopenta-1,3-diene?
The IUPAC name of tris(dimethylazanide);hafnium(4+);5-(2-methylpropyl)cyclopenta-1,3-diene (CID 155667440) is tris(dimethylazanide);hafnium(4+);5-(2-methylpropyl)cyclopenta-1,3-diene.
What is the SMILES notation for tris(dimethylazanide);hafnium(4+);5-(2-methylpropyl)cyclopenta-1,3-diene?
The canonical SMILES for tris(dimethylazanide);hafnium(4+);5-(2-methylpropyl)cyclopenta-1,3-diene is CC(C)C[c-]1cccc1.C[N-]C.C[N-]C.C[N-]C.[Hf+4].
What is the InChIKey of tris(dimethylazanide);hafnium(4+);5-(2-methylpropyl)cyclopenta-1,3-diene?
The InChIKey is FGEISUFAJQWKNE-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13.3C2H6N.Hf/c1-8(2)7-9-5-3-4-6-9;3*1-3-2;/h3-6,8H,7H2,1-2H3;3*1-2H3;/q4*-1;+4.
What are the key properties of tris(dimethylazanide);hafnium(4+);5-(2-methylpropyl)cyclopenta-1,3-diene?
tris(dimethylazanide);hafnium(4+);5-(2-methylpropyl)cyclopenta-1,3-diene has a molecular weight of 431.92 g/mol, XLogP of 4.46, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for tris(dimethylazanide);hafnium(4+);5-(2-methylpropyl)cyclopenta-1,3-diene is sourced from PubChem (CID 155667440), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).