C15H31HfN3 — CID 155667440
tris(dimethylazanide);hafnium(4+);5-(2-methylpropyl)cyclopenta-1,3-diene (PubChem CID 155667440) has the molecular formula C15H31HfN3 and a molecular weight of 431.92 g/mol. Its IUPAC name is tris(dimethylazanide);hafnium(4+);5-(2-methylpropyl)cyclopenta-1,3-diene.
| Compound Name | tris(dimethylazanide);hafnium(4+);5-(2-methylpropyl)cyclopenta-1,3-diene |
|---|---|
| PubChem CID | 155667440 |
| Molecular Formula | C15H31HfN3 |
| Molecular Weight | 431.92 g/mol |
| Exact Mass | 433.20 |
| IUPAC Name | tris(dimethylazanide);hafnium(4+);5-(2-methylpropyl)cyclopenta-1,3-diene |
| SMILES | CC(C)C[c-]1cccc1.C[N-]C.C[N-]C.C[N-]C.[Hf+4] |
| InChI | InChI=1S/C9H13.3C2H6N.Hf/c1-8(2)7-9-5-3-4-6-9;3*1-3-2;/h3-6,8H,7H2,1-2H3;3*1-2H3;/q4*-1;+4 |
| InChIKey | FGEISUFAJQWKNE-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 42.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.92 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|