C13H18FeSi-6 — CID 173174965
1-cyclopenta-2,4-dien-1-ylpropan-2-ylsilane;cyclopentane;iron (PubChem CID 173174965) has the molecular formula C13H18FeSi-6 and a molecular weight of 258.22 g/mol. Its IUPAC name is 1-cyclopenta-2,4-dien-1-ylpropan-2-ylsilane;cyclopentane;iron.
| Compound Name | 1-cyclopenta-2,4-dien-1-ylpropan-2-ylsilane;cyclopentane;iron |
|---|---|
| PubChem CID | 173174965 |
| Molecular Formula | C13H18FeSi-6 |
| Molecular Weight | 258.22 g/mol |
| Exact Mass | 258.06 |
| IUPAC Name | 1-cyclopenta-2,4-dien-1-ylpropan-2-ylsilane;cyclopentane;iron |
| SMILES | CC([SiH3])C[c-]1cccc1.[Fe].[cH-]1[cH-][cH-][cH-][cH-]1 |
| InChI | InChI=1S/C8H13Si.C5H5.Fe/c1-7(9)6-8-4-2-3-5-8;1-2-4-5-3-1;/h2-5,7H,6H2,1,9H3;1-5H;/q-1;-5; |
| InChIKey | WLYLWPGSVSLPCX-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.22 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|