C14H16Fe-6 — CID 175300525
5-but-3-en-2-ylcyclopenta-1,3-diene;cyclopentane;iron (PubChem CID 175300525) has the molecular formula C14H16Fe-6 and a molecular weight of 240.13 g/mol. Its IUPAC name is 5-but-3-en-2-ylcyclopenta-1,3-diene;cyclopentane;iron.
| Compound Name | 5-but-3-en-2-ylcyclopenta-1,3-diene;cyclopentane;iron |
|---|---|
| PubChem CID | 175300525 |
| Molecular Formula | C14H16Fe-6 |
| Molecular Weight | 240.13 g/mol |
| Exact Mass | 240.06 |
| IUPAC Name | 5-but-3-en-2-ylcyclopenta-1,3-diene;cyclopentane;iron |
| SMILES | C=CC(C)[c-]1cccc1.[Fe].[cH-]1[cH-][cH-][cH-][cH-]1 |
| InChI | InChI=1S/C9H11.C5H5.Fe/c1-3-8(2)9-6-4-5-7-9;1-2-4-5-3-1;/h3-8H,1H2,2H3;1-5H;/q-1;-5; |
| InChIKey | BTBAFJUEPWYOPX-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.13 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|