C9H13KO — CID 135046538
potassium 5-[(2R)-1-methoxypropan-2-yl]cyclopenta-1,3-diene (PubChem CID 135046538) has the molecular formula C9H13KO and a molecular weight of 176.30 g/mol. Its IUPAC name is potassium 5-[(2R)-1-methoxypropan-2-yl]cyclopenta-1,3-diene.
| Compound Name | potassium 5-[(2R)-1-methoxypropan-2-yl]cyclopenta-1,3-diene |
|---|---|
| PubChem CID | 135046538 |
| Molecular Formula | C9H13KO |
| Molecular Weight | 176.30 g/mol |
| Exact Mass | 176.06 |
| IUPAC Name | potassium 5-[(2R)-1-methoxypropan-2-yl]cyclopenta-1,3-diene |
| SMILES | COC[C@H](C)[c-]1cccc1.[K+] |
| InChI | InChI=1S/C9H13O.K/c1-8(7-10-2)9-5-3-4-6-9;/h3-6,8H,7H2,1-2H3;/q-1;+1/t8-;/m0./s1 |
| InChIKey | KQCONUWOSIAEKJ-QRPNPIFTSA-N |
| XLogP | -0.84 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.30 |
| LogP ≤ 5 | -0.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|