About potassium 1-methoxypropan-2-olate
potassium 1-methoxypropan-2-olate (PubChem CID 142707794) has the molecular formula C4H9KO2
and a molecular weight of 128.21 g/mol. Its IUPAC name is potassium 1-methoxypropan-2-olate.
Molecular Properties
| Compound Name | potassium 1-methoxypropan-2-olate |
| PubChem CID | 142707794 |
| Molecular Formula | C4H9KO2 |
| Molecular Weight | 128.21 g/mol |
| Exact Mass | 128.02 |
| IUPAC Name | potassium 1-methoxypropan-2-olate |
| SMILES | COCC(C)[O-].[K+] |
| InChI | InChI=1S/C4H9O2.K/c1-4(5)3-6-2;/h4H,3H2,1-2H3;/q-1;+1 |
| InChIKey | OVBFEZKUJAUFRJ-UHFFFAOYSA-N |
| XLogP | -3.61 |
| TPSA | 32.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 128.21 |
| LogP ≤ 5 | -3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze potassium 1-methoxypropan-2-olate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of potassium 1-methoxypropan-2-olate?
The IUPAC name of potassium 1-methoxypropan-2-olate (CID 142707794) is potassium 1-methoxypropan-2-olate.
What is the SMILES notation for potassium 1-methoxypropan-2-olate?
The canonical SMILES for potassium 1-methoxypropan-2-olate is COCC(C)[O-].[K+].
What is the InChIKey of potassium 1-methoxypropan-2-olate?
The InChIKey is OVBFEZKUJAUFRJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H9O2.K/c1-4(5)3-6-2;/h4H,3H2,1-2H3;/q-1;+1.
What are the key properties of potassium 1-methoxypropan-2-olate?
potassium 1-methoxypropan-2-olate has a molecular weight of 128.21 g/mol, XLogP of -3.61, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for potassium 1-methoxypropan-2-olate is sourced from PubChem (CID 142707794), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).