C14H16Fe-6 — CID 175459313
cyclopentane;iron;5-(2-methylprop-2-enyl)cyclopenta-1,3-diene (PubChem CID 175459313) has the molecular formula C14H16Fe-6 and a molecular weight of 240.13 g/mol. Its IUPAC name is cyclopentane;iron;5-(2-methylprop-2-enyl)cyclopenta-1,3-diene.
| Compound Name | cyclopentane;iron;5-(2-methylprop-2-enyl)cyclopenta-1,3-diene |
|---|---|
| PubChem CID | 175459313 |
| Molecular Formula | C14H16Fe-6 |
| Molecular Weight | 240.13 g/mol |
| Exact Mass | 240.06 |
| IUPAC Name | cyclopentane;iron;5-(2-methylprop-2-enyl)cyclopenta-1,3-diene |
| SMILES | C=C(C)C[c-]1cccc1.[Fe].[cH-]1[cH-][cH-][cH-][cH-]1 |
| InChI | InChI=1S/C9H11.C5H5.Fe/c1-8(2)7-9-5-3-4-6-9;1-2-4-5-3-1;/h3-6H,1,7H2,2H3;1-5H;/q-1;-5; |
| InChIKey | XGUVASFDIXAVEV-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.13 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|