C24H50CoNP2+ — CID 11987342
cobalt;2-cyclopenta-2,4-dien-1-yl-N,N-dimethylethanamine;3-di(propan-2-yl)phosphaniumylpropyl-di(propan-2-yl)phosphanium (PubChem CID 11987342) has the molecular formula C24H50CoNP2+ and a molecular weight of 473.55 g/mol. Its IUPAC name is cobalt;2-cyclopenta-2,4-dien-1-yl-N,N-dimethylethanamine;3-di(propan-2-yl)phosphaniumylpropyl-di(propan-2-yl)phosphanium.
| Compound Name | cobalt;2-cyclopenta-2,4-dien-1-yl-N,N-dimethylethanamine;3-di(propan-2-yl)phosphaniumylpropyl-di(propan-2-yl)phosphanium |
|---|---|
| PubChem CID | 11987342 |
| Molecular Formula | C24H50CoNP2+ |
| Molecular Weight | 473.55 g/mol |
| Exact Mass | 473.27 |
| IUPAC Name | cobalt;2-cyclopenta-2,4-dien-1-yl-N,N-dimethylethanamine;3-di(propan-2-yl)phosphaniumylpropyl-di(propan-2-yl)phosphanium |
| SMILES | CC(C)[PH+](CCC[PH+](C(C)C)C(C)C)C(C)C.CN(C)CC[c-]1cccc1.[Co] |
| InChI | InChI=1S/C15H34P2.C9H14N.Co/c1-12(2)16(13(3)4)10-9-11-17(14(5)6)15(7)8;1-10(2)8-7-9-5-3-4-6-9;/h12-15H,9-11H2,1-8H3;3-6H,7-8H2,1-2H3;/q;-1;/p+2 |
| InChIKey | NPLFZZBUBWTUKD-UHFFFAOYSA-P |
| XLogP | 6.95 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.55 |
| LogP ≤ 5 | 6.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|