C22H26MnN- — CID 11986694
1,1'-biphenyl;3-cyclopenta-2,4-dien-1-yl-N,N-dimethylpropan-1-amine;manganese (PubChem CID 11986694) has the molecular formula C22H26MnN- and a molecular weight of 359.40 g/mol. Its IUPAC name is 1,1'-biphenyl;3-cyclopenta-2,4-dien-1-yl-N,N-dimethylpropan-1-amine;manganese.
| Compound Name | 1,1'-biphenyl;3-cyclopenta-2,4-dien-1-yl-N,N-dimethylpropan-1-amine;manganese |
|---|---|
| PubChem CID | 11986694 |
| Molecular Formula | C22H26MnN- |
| Molecular Weight | 359.40 g/mol |
| Exact Mass | 359.15 |
| IUPAC Name | 1,1'-biphenyl;3-cyclopenta-2,4-dien-1-yl-N,N-dimethylpropan-1-amine;manganese |
| SMILES | CN(C)CCC[c-]1cccc1.[Mn].c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C12H10.C10H16N.Mn/c1-3-7-11(8-4-1)12-9-5-2-6-10-12;1-11(2)9-5-8-10-6-3-4-7-10;/h1-10H;3-4,6-7H,5,8-9H2,1-2H3;/q;-1; |
| InChIKey | BGEOGVBXYWOIHQ-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.40 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|