About 1-chloro-4-phenylbenzene;6-(dimethylamino)hexanoic acid
1-chloro-4-phenylbenzene;6-(dimethylamino)hexanoic acid (PubChem CID 67597280) has the molecular formula C20H26ClNO2
and a molecular weight of 347.89 g/mol. Its IUPAC name is 1-chloro-4-phenylbenzene;6-(dimethylamino)hexanoic acid.
Molecular Properties
| Compound Name | 1-chloro-4-phenylbenzene;6-(dimethylamino)hexanoic acid |
| PubChem CID | 67597280 |
| Molecular Formula | C20H26ClNO2 |
| Molecular Weight | 347.89 g/mol |
| Exact Mass | 347.17 |
| IUPAC Name | 1-chloro-4-phenylbenzene;6-(dimethylamino)hexanoic acid |
| SMILES | CN(C)CCCCCC(=O)O.Clc1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C12H9Cl.C8H17NO2/c13-12-8-6-11(7-9-12)10-4-2-1-3-5-10;1-9(2)7-5-3-4-6-8(10)11/h1-9H;3-7H2,1-2H3,(H,10,11) |
| InChIKey | WOHLHEXFXPGVNE-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 347.89 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-chloro-4-phenylbenzene;6-(dimethylamino)hexanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-chloro-4-phenylbenzene;6-(dimethylamino)hexanoic acid?
The IUPAC name of 1-chloro-4-phenylbenzene;6-(dimethylamino)hexanoic acid (CID 67597280) is 1-chloro-4-phenylbenzene;6-(dimethylamino)hexanoic acid.
What is the SMILES notation for 1-chloro-4-phenylbenzene;6-(dimethylamino)hexanoic acid?
The canonical SMILES for 1-chloro-4-phenylbenzene;6-(dimethylamino)hexanoic acid is CN(C)CCCCCC(=O)O.Clc1ccc(-c2ccccc2)cc1.
What is the InChIKey of 1-chloro-4-phenylbenzene;6-(dimethylamino)hexanoic acid?
The InChIKey is WOHLHEXFXPGVNE-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H9Cl.C8H17NO2/c13-12-8-6-11(7-9-12)10-4-2-1-3-5-10;1-9(2)7-5-3-4-6-8(10)11/h1-9H;3-7H2,1-2H3,(H,10,11).
What are the key properties of 1-chloro-4-phenylbenzene;6-(dimethylamino)hexanoic acid?
1-chloro-4-phenylbenzene;6-(dimethylamino)hexanoic acid has a molecular weight of 347.89 g/mol, XLogP of 5.20, 7 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-chloro-4-phenylbenzene;6-(dimethylamino)hexanoic acid is sourced from PubChem (CID 67597280), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).