C22H24Cl2N2O — CID 159047253
1-(7-chloro-2-phenylquinolin-4-yl)-5-(dimethylamino)pentan-1-one;hydrochloride (PubChem CID 159047253) has the molecular formula C22H24Cl2N2O and a molecular weight of 403.35 g/mol. Its IUPAC name is 1-(7-chloro-2-phenylquinolin-4-yl)-5-(dimethylamino)pentan-1-one;hydrochloride.
| Compound Name | 1-(7-chloro-2-phenylquinolin-4-yl)-5-(dimethylamino)pentan-1-one;hydrochloride |
|---|---|
| PubChem CID | 159047253 |
| Molecular Formula | C22H24Cl2N2O |
| Molecular Weight | 403.35 g/mol |
| Exact Mass | 402.13 |
| IUPAC Name | 1-(7-chloro-2-phenylquinolin-4-yl)-5-(dimethylamino)pentan-1-one;hydrochloride |
| SMILES | CN(C)CCCCC(=O)c1cc(-c2ccccc2)nc2cc(Cl)ccc12.Cl |
| InChI | InChI=1S/C22H23ClN2O.ClH/c1-25(2)13-7-6-10-22(26)19-15-20(16-8-4-3-5-9-16)24-21-14-17(23)11-12-18(19)21;/h3-5,8-9,11-12,14-15H,6-7,10,13H2,1-2H3;1H |
| InChIKey | DGPXCQXOQVMFBE-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.35 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|