C21H19F3N2O — CID 159340286
4-(dimethylamino)-1-[2-(3,4,5-trifluorophenyl)quinolin-4-yl]butan-1-one (PubChem CID 159340286) has the molecular formula C21H19F3N2O and a molecular weight of 372.39 g/mol. Its IUPAC name is 4-(dimethylamino)-1-[2-(3,4,5-trifluorophenyl)quinolin-4-yl]butan-1-one.
| Compound Name | 4-(dimethylamino)-1-[2-(3,4,5-trifluorophenyl)quinolin-4-yl]butan-1-one |
|---|---|
| PubChem CID | 159340286 |
| Molecular Formula | C21H19F3N2O |
| Molecular Weight | 372.39 g/mol |
| Exact Mass | 372.14 |
| IUPAC Name | 4-(dimethylamino)-1-[2-(3,4,5-trifluorophenyl)quinolin-4-yl]butan-1-one |
| SMILES | CN(C)CCCC(=O)c1cc(-c2cc(F)c(F)c(F)c2)nc2ccccc12 |
| InChI | InChI=1S/C21H19F3N2O/c1-26(2)9-5-8-20(27)15-12-19(25-18-7-4-3-6-14(15)18)13-10-16(22)21(24)17(23)11-13/h3-4,6-7,10-12H,5,8-9H2,1-2H3 |
| InChIKey | LGBARDBENAVQIL-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.39 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|