C21H21N3O3 — CID 39491212
methyl 4-[methyl-(2-pyridin-4-ylquinoline-4-carbonyl)amino]butanoate (PubChem CID 39491212) has the molecular formula C21H21N3O3 and a molecular weight of 363.42 g/mol. Its IUPAC name is methyl 4-[methyl-(2-pyridin-4-ylquinoline-4-carbonyl)amino]butanoate.
| Compound Name | methyl 4-[methyl-(2-pyridin-4-ylquinoline-4-carbonyl)amino]butanoate |
|---|---|
| PubChem CID | 39491212 |
| Molecular Formula | C21H21N3O3 |
| Molecular Weight | 363.42 g/mol |
| Exact Mass | 363.16 |
| IUPAC Name | methyl 4-[methyl-(2-pyridin-4-ylquinoline-4-carbonyl)amino]butanoate |
| SMILES | COC(=O)CCCN(C)C(=O)c1cc(-c2ccncc2)nc2ccccc12 |
| InChI | InChI=1S/C21H21N3O3/c1-24(13-5-8-20(25)27-2)21(26)17-14-19(15-9-11-22-12-10-15)23-18-7-4-3-6-16(17)18/h3-4,6-7,9-12,14H,5,8,13H2,1-2H3 |
| InChIKey | PTGWCWXPLMTUKQ-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 72.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.42 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |