C21H17F5N2O — CID 160902489
4-(dimethylamino)-1-[2-(2,3,4,5,6-pentafluorophenyl)quinolin-4-yl]butan-1-one (PubChem CID 160902489) has the molecular formula C21H17F5N2O and a molecular weight of 408.37 g/mol. Its IUPAC name is 4-(dimethylamino)-1-[2-(2,3,4,5,6-pentafluorophenyl)quinolin-4-yl]butan-1-one.
| Compound Name | 4-(dimethylamino)-1-[2-(2,3,4,5,6-pentafluorophenyl)quinolin-4-yl]butan-1-one |
|---|---|
| PubChem CID | 160902489 |
| Molecular Formula | C21H17F5N2O |
| Molecular Weight | 408.37 g/mol |
| Exact Mass | 408.13 |
| IUPAC Name | 4-(dimethylamino)-1-[2-(2,3,4,5,6-pentafluorophenyl)quinolin-4-yl]butan-1-one |
| SMILES | CN(C)CCCC(=O)c1cc(-c2c(F)c(F)c(F)c(F)c2F)nc2ccccc12 |
| InChI | InChI=1S/C21H17F5N2O/c1-28(2)9-5-8-15(29)12-10-14(27-13-7-4-3-6-11(12)13)16-17(22)19(24)21(26)20(25)18(16)23/h3-4,6-7,10H,5,8-9H2,1-2H3 |
| InChIKey | SPRQUNIDMYKXMY-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.37 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|