C21H23Cl2N3O5S2 — CID 90462549
N-[3-[bis(methylsulfonyl)amino]propyl]-7-chloro-2-phenylquinoline-4-carboxamide;hydrochloride (PubChem CID 90462549) has the molecular formula C21H23Cl2N3O5S2 and a molecular weight of 532.47 g/mol. Its IUPAC name is N-[3-[bis(methylsulfonyl)amino]propyl]-7-chloro-2-phenylquinoline-4-carboxamide;hydrochloride.
| Compound Name | N-[3-[bis(methylsulfonyl)amino]propyl]-7-chloro-2-phenylquinoline-4-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 90462549 |
| Molecular Formula | C21H23Cl2N3O5S2 |
| Molecular Weight | 532.47 g/mol |
| Exact Mass | 531.05 |
| IUPAC Name | N-[3-[bis(methylsulfonyl)amino]propyl]-7-chloro-2-phenylquinoline-4-carboxamide;hydrochloride |
| SMILES | CS(=O)(=O)N(CCCNC(=O)c1cc(-c2ccccc2)nc2cc(Cl)ccc12)S(C)(=O)=O.Cl |
| InChI | InChI=1S/C21H22ClN3O5S2.ClH/c1-31(27,28)25(32(2,29)30)12-6-11-23-21(26)18-14-19(15-7-4-3-5-8-15)24-20-13-16(22)9-10-17(18)20;/h3-5,7-10,13-14H,6,11-12H2,1-2H3,(H,23,26);1H |
| InChIKey | WZAPNBLPIBKRKR-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 113.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.47 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|