C11H10ORu — CID 15809045
cyclopenta-1,3-diene;cyclopenta-2,4-diene-1-carbaldehyde;ruthenium(2+) (PubChem CID 15809045) has the molecular formula C11H10ORu and a molecular weight of 259.27 g/mol. Its IUPAC name is cyclopenta-1,3-diene;cyclopenta-2,4-diene-1-carbaldehyde;ruthenium(2+).
| Compound Name | cyclopenta-1,3-diene;cyclopenta-2,4-diene-1-carbaldehyde;ruthenium(2+) |
|---|---|
| PubChem CID | 15809045 |
| Molecular Formula | C11H10ORu |
| Molecular Weight | 259.27 g/mol |
| Exact Mass | 259.98 |
| IUPAC Name | cyclopenta-1,3-diene;cyclopenta-2,4-diene-1-carbaldehyde;ruthenium(2+) |
| SMILES | O=C[c-]1cccc1.[Ru+2].c1cc[cH-]c1 |
| InChI | InChI=1S/C6H5O.C5H5.Ru/c7-5-6-3-1-2-4-6;1-2-4-5-3-1;/h1-5H;1-5H;/q2*-1;+2 |
| InChIKey | FBGSFTHPXHLDGP-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.27 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|