C13H14Fe — CID 161401239
cyclopenta-1,3-diene;iron(2+);5-prop-1-enylcyclopenta-1,3-diene (PubChem CID 161401239) has the molecular formula C13H14Fe and a molecular weight of 226.10 g/mol. Its IUPAC name is cyclopenta-1,3-diene;iron(2+);5-prop-1-enylcyclopenta-1,3-diene.
| Compound Name | cyclopenta-1,3-diene;iron(2+);5-prop-1-enylcyclopenta-1,3-diene |
|---|---|
| PubChem CID | 161401239 |
| Molecular Formula | C13H14Fe |
| Molecular Weight | 226.10 g/mol |
| Exact Mass | 226.04 |
| IUPAC Name | cyclopenta-1,3-diene;iron(2+);5-prop-1-enylcyclopenta-1,3-diene |
| SMILES | CC=C[c-]1cccc1.[Fe+2].c1cc[cH-]c1 |
| InChI | InChI=1S/C8H9.C5H5.Fe/c1-2-5-8-6-3-4-7-8;1-2-4-5-3-1;/h2-7H,1H3;1-5H;/q2*-1;+2 |
| InChIKey | VUGPBKATBHXPJK-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.10 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|