C14H14Fe — CID 131724260
5-buta-1,3-dienylcyclopenta-1,3-diene;cyclopenta-1,3-diene;iron(2+) (PubChem CID 131724260) has the molecular formula C14H14Fe and a molecular weight of 238.11 g/mol. Its IUPAC name is 5-buta-1,3-dienylcyclopenta-1,3-diene;cyclopenta-1,3-diene;iron(2+).
| Compound Name | 5-buta-1,3-dienylcyclopenta-1,3-diene;cyclopenta-1,3-diene;iron(2+) |
|---|---|
| PubChem CID | 131724260 |
| Molecular Formula | C14H14Fe |
| Molecular Weight | 238.11 g/mol |
| Exact Mass | 238.04 |
| IUPAC Name | 5-buta-1,3-dienylcyclopenta-1,3-diene;cyclopenta-1,3-diene;iron(2+) |
| SMILES | C=CC=C[c-]1cccc1.[Fe+2].c1cc[cH-]c1 |
| InChI | InChI=1S/C9H9.C5H5.Fe/c1-2-3-6-9-7-4-5-8-9;1-2-4-5-3-1;/h2-8H,1H2;1-5H;/q2*-1;+2 |
| InChIKey | WSBITBYIJJHACL-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.11 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|