C19H28FeO3Si — CID 170995244
cyclopenta-1,3-diene;[(E)-1-cyclopenta-2,4-dien-1-ylprop-1-enyl]-triethoxysilane;iron(2+) (PubChem CID 170995244) has the molecular formula C19H28FeO3Si and a molecular weight of 388.36 g/mol. Its IUPAC name is cyclopenta-1,3-diene;[(E)-1-cyclopenta-2,4-dien-1-ylprop-1-enyl]-triethoxysilane;iron(2+).
| Compound Name | cyclopenta-1,3-diene;[(E)-1-cyclopenta-2,4-dien-1-ylprop-1-enyl]-triethoxysilane;iron(2+) |
|---|---|
| PubChem CID | 170995244 |
| Molecular Formula | C19H28FeO3Si |
| Molecular Weight | 388.36 g/mol |
| Exact Mass | 388.12 |
| IUPAC Name | cyclopenta-1,3-diene;[(E)-1-cyclopenta-2,4-dien-1-ylprop-1-enyl]-triethoxysilane;iron(2+) |
| SMILES | C/C=C(\[c-]1cccc1)[Si](OCC)(OCC)OCC.[Fe+2].c1cc[cH-]c1 |
| InChI | InChI=1S/C14H23O3Si.C5H5.Fe/c1-5-14(13-11-9-10-12-13)18(15-6-2,16-7-3)17-8-4;1-2-4-5-3-1;/h5,9-12H,6-8H2,1-4H3;1-5H;/q2*-1;+2/b14-5+;; |
| InChIKey | MIHKEEKQNFGUGQ-UPWXDAOZSA-N |
| XLogP | 4.80 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.36 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|