C20H30FeO3Si — CID 170995252
cyclopenta-1,3-diene;[(Z)-4-cyclopenta-2,4-dien-1-ylbut-1-enyl]-triethoxysilane;iron(2+) (PubChem CID 170995252) has the molecular formula C20H30FeO3Si and a molecular weight of 402.39 g/mol. Its IUPAC name is cyclopenta-1,3-diene;[(Z)-4-cyclopenta-2,4-dien-1-ylbut-1-enyl]-triethoxysilane;iron(2+).
| Compound Name | cyclopenta-1,3-diene;[(Z)-4-cyclopenta-2,4-dien-1-ylbut-1-enyl]-triethoxysilane;iron(2+) |
|---|---|
| PubChem CID | 170995252 |
| Molecular Formula | C20H30FeO3Si |
| Molecular Weight | 402.39 g/mol |
| Exact Mass | 402.13 |
| IUPAC Name | cyclopenta-1,3-diene;[(Z)-4-cyclopenta-2,4-dien-1-ylbut-1-enyl]-triethoxysilane;iron(2+) |
| SMILES | CCO[Si](/C=C\CC[c-]1cccc1)(OCC)OCC.[Fe+2].c1cc[cH-]c1 |
| InChI | InChI=1S/C15H25O3Si.C5H5.Fe/c1-4-16-19(17-5-2,18-6-3)14-10-9-13-15-11-7-8-12-15;1-2-4-5-3-1;/h7-8,10-12,14H,4-6,9,13H2,1-3H3;1-5H;/q2*-1;+2/b14-10-;; |
| InChIKey | LCPMDOGKXKJVGA-UFMFWQRBSA-N |
| XLogP | 4.88 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.39 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|