C12H14FeN2 — CID 170553060
cyclopenta-1,3-diene;1-cyclopenta-2,4-dien-1-ylethylidenehydrazine;iron(2+) (PubChem CID 170553060) has the molecular formula C12H14FeN2 and a molecular weight of 242.10 g/mol. Its IUPAC name is cyclopenta-1,3-diene;1-cyclopenta-2,4-dien-1-ylethylidenehydrazine;iron(2+).
| Compound Name | cyclopenta-1,3-diene;1-cyclopenta-2,4-dien-1-ylethylidenehydrazine;iron(2+) |
|---|---|
| PubChem CID | 170553060 |
| Molecular Formula | C12H14FeN2 |
| Molecular Weight | 242.10 g/mol |
| Exact Mass | 242.05 |
| IUPAC Name | cyclopenta-1,3-diene;1-cyclopenta-2,4-dien-1-ylethylidenehydrazine;iron(2+) |
| SMILES | CC(=NN)[c-]1cccc1.[Fe+2].c1cc[cH-]c1 |
| InChI | InChI=1S/C7H9N2.C5H5.Fe/c1-6(9-8)7-4-2-3-5-7;1-2-4-5-3-1;/h2-5H,8H2,1H3;1-5H;/q2*-1;+2 |
| InChIKey | LXWTWXWWNUJZEJ-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.10 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|