C12H14FeO+4 — CID 139238382
cyclopenta-1,3-diene;1-cyclopenta-2,4-dien-1-ylethanol;iron(6+) (PubChem CID 139238382) has the molecular formula C12H14FeO+4 and a molecular weight of 230.09 g/mol. Its IUPAC name is cyclopenta-1,3-diene;1-cyclopenta-2,4-dien-1-ylethanol;iron(6+).
| Compound Name | cyclopenta-1,3-diene;1-cyclopenta-2,4-dien-1-ylethanol;iron(6+) |
|---|---|
| PubChem CID | 139238382 |
| Molecular Formula | C12H14FeO+4 |
| Molecular Weight | 230.09 g/mol |
| Exact Mass | 230.04 |
| IUPAC Name | cyclopenta-1,3-diene;1-cyclopenta-2,4-dien-1-ylethanol;iron(6+) |
| SMILES | CC(O)[c-]1cccc1.[Fe+6].c1cc[cH-]c1 |
| InChI | InChI=1S/C7H9O.C5H5.Fe/c1-6(8)7-4-2-3-5-7;1-2-4-5-3-1;/h2-6,8H,1H3;1-5H;/q2*-1;+6 |
| InChIKey | OOKSKHUWWBHJJL-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.09 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|