C18H28FeO3Si — CID 157273131
cyclopenta-1,3-diene;2-cyclopenta-1,3-dien-1-ylethyl(triethoxy)silane;iron(2+) (PubChem CID 157273131) has the molecular formula C18H28FeO3Si and a molecular weight of 376.35 g/mol. Its IUPAC name is cyclopenta-1,3-diene;2-cyclopenta-1,3-dien-1-ylethyl(triethoxy)silane;iron(2+).
| Compound Name | cyclopenta-1,3-diene;2-cyclopenta-1,3-dien-1-ylethyl(triethoxy)silane;iron(2+) |
|---|---|
| PubChem CID | 157273131 |
| Molecular Formula | C18H28FeO3Si |
| Molecular Weight | 376.35 g/mol |
| Exact Mass | 376.12 |
| IUPAC Name | cyclopenta-1,3-diene;2-cyclopenta-1,3-dien-1-ylethyl(triethoxy)silane;iron(2+) |
| SMILES | CCO[Si](CCc1ccc[cH-]1)(OCC)OCC.[Fe+2].c1cc[cH-]c1 |
| InChI | InChI=1S/C13H23O3Si.C5H5.Fe/c1-4-14-17(15-5-2,16-6-3)12-11-13-9-7-8-10-13;1-2-4-5-3-1;/h7-10H,4-6,11-12H2,1-3H3;1-5H;/q2*-1;+2 |
| InChIKey | AYTSSQJFOKKBEJ-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.35 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|