C17H30O6Si — CID 90121012
triethoxy-[2-(2,3,6-trimethoxyphenyl)ethyl]silane (PubChem CID 90121012) has the molecular formula C17H30O6Si and a molecular weight of 358.51 g/mol. Its IUPAC name is triethoxy-[2-(2,3,6-trimethoxyphenyl)ethyl]silane.
| Compound Name | triethoxy-[2-(2,3,6-trimethoxyphenyl)ethyl]silane |
|---|---|
| PubChem CID | 90121012 |
| Molecular Formula | C17H30O6Si |
| Molecular Weight | 358.51 g/mol |
| Exact Mass | 358.18 |
| IUPAC Name | triethoxy-[2-(2,3,6-trimethoxyphenyl)ethyl]silane |
| SMILES | CCO[Si](CCc1c(OC)ccc(OC)c1OC)(OCC)OCC |
| InChI | InChI=1S/C17H30O6Si/c1-7-21-24(22-8-2,23-9-3)13-12-14-15(18-4)10-11-16(19-5)17(14)20-6/h10-11H,7-9,12-13H2,1-6H3 |
| InChIKey | NFZODRZPYZRLHH-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.51 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|