C15H26O6Si — CID 174513383
trimethoxy-[3-(2,3,4-trimethoxyphenyl)propyl]silane (PubChem CID 174513383) has the molecular formula C15H26O6Si and a molecular weight of 330.45 g/mol. Its IUPAC name is trimethoxy-[3-(2,3,4-trimethoxyphenyl)propyl]silane.
| Compound Name | trimethoxy-[3-(2,3,4-trimethoxyphenyl)propyl]silane |
|---|---|
| PubChem CID | 174513383 |
| Molecular Formula | C15H26O6Si |
| Molecular Weight | 330.45 g/mol |
| Exact Mass | 330.15 |
| IUPAC Name | trimethoxy-[3-(2,3,4-trimethoxyphenyl)propyl]silane |
| SMILES | COc1ccc(CCC[Si](OC)(OC)OC)c(OC)c1OC |
| InChI | InChI=1S/C15H26O6Si/c1-16-13-10-9-12(14(17-2)15(13)18-3)8-7-11-22(19-4,20-5)21-6/h9-10H,7-8,11H2,1-6H3 |
| InChIKey | CWKCNLIFWYPUQN-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.45 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|