C13H21NO4 — CID 65305545
2-[2-(2,3,4-trimethoxyphenyl)ethoxy]ethanamine (PubChem CID 65305545) has the molecular formula C13H21NO4 and a molecular weight of 255.31 g/mol. Its IUPAC name is 2-[2-(2,3,4-trimethoxyphenyl)ethoxy]ethanamine.
| Compound Name | 2-[2-(2,3,4-trimethoxyphenyl)ethoxy]ethanamine |
|---|---|
| PubChem CID | 65305545 |
| Molecular Formula | C13H21NO4 |
| Molecular Weight | 255.31 g/mol |
| Exact Mass | 255.15 |
| IUPAC Name | 2-[2-(2,3,4-trimethoxyphenyl)ethoxy]ethanamine |
| SMILES | COc1ccc(CCOCCN)c(OC)c1OC |
| InChI | InChI=1S/C13H21NO4/c1-15-11-5-4-10(6-8-18-9-7-14)12(16-2)13(11)17-3/h4-5H,6-9,14H2,1-3H3 |
| InChIKey | WAELEIDAQDGPCR-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 62.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.31 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|