C16H25NO4 — CID 65303577
N-[2-[2-(2,3,4-trimethoxyphenyl)ethoxy]ethyl]cyclopropanamine (PubChem CID 65303577) has the molecular formula C16H25NO4 and a molecular weight of 295.38 g/mol. Its IUPAC name is N-[2-[2-(2,3,4-trimethoxyphenyl)ethoxy]ethyl]cyclopropanamine.
| Compound Name | N-[2-[2-(2,3,4-trimethoxyphenyl)ethoxy]ethyl]cyclopropanamine |
|---|---|
| PubChem CID | 65303577 |
| Molecular Formula | C16H25NO4 |
| Molecular Weight | 295.38 g/mol |
| Exact Mass | 295.18 |
| IUPAC Name | N-[2-[2-(2,3,4-trimethoxyphenyl)ethoxy]ethyl]cyclopropanamine |
| SMILES | COc1ccc(CCOCCNC2CC2)c(OC)c1OC |
| InChI | InChI=1S/C16H25NO4/c1-18-14-7-4-12(15(19-2)16(14)20-3)8-10-21-11-9-17-13-5-6-13/h4,7,13,17H,5-6,8-11H2,1-3H3 |
| InChIKey | IVKCUBNQAJBZHE-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 48.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.38 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|