C15H25NO3 — CID 64865802
2-methyl-N-[2-(2,3,4-trimethoxyphenyl)ethyl]propan-2-amine (PubChem CID 64865802) has the molecular formula C15H25NO3 and a molecular weight of 267.37 g/mol. Its IUPAC name is 2-methyl-N-[2-(2,3,4-trimethoxyphenyl)ethyl]propan-2-amine.
| Compound Name | 2-methyl-N-[2-(2,3,4-trimethoxyphenyl)ethyl]propan-2-amine |
|---|---|
| PubChem CID | 64865802 |
| Molecular Formula | C15H25NO3 |
| Molecular Weight | 267.37 g/mol |
| Exact Mass | 267.18 |
| IUPAC Name | 2-methyl-N-[2-(2,3,4-trimethoxyphenyl)ethyl]propan-2-amine |
| SMILES | COc1ccc(CCNC(C)(C)C)c(OC)c1OC |
| InChI | InChI=1S/C15H25NO3/c1-15(2,3)16-10-9-11-7-8-12(17-4)14(19-6)13(11)18-5/h7-8,16H,9-10H2,1-6H3 |
| InChIKey | WINLHEAOHTWXIZ-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.37 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |