C13H22N2O3 — CID 104867748
(2S)-2-N-[(2,3,4-trimethoxyphenyl)methyl]propane-1,2-diamine (PubChem CID 104867748) has the molecular formula C13H22N2O3 and a molecular weight of 254.33 g/mol. Its IUPAC name is (2S)-2-N-[(2,3,4-trimethoxyphenyl)methyl]propane-1,2-diamine.
| Compound Name | (2S)-2-N-[(2,3,4-trimethoxyphenyl)methyl]propane-1,2-diamine |
|---|---|
| PubChem CID | 104867748 |
| Molecular Formula | C13H22N2O3 |
| Molecular Weight | 254.33 g/mol |
| Exact Mass | 254.16 |
| IUPAC Name | (2S)-2-N-[(2,3,4-trimethoxyphenyl)methyl]propane-1,2-diamine |
| SMILES | COc1ccc(CN[C@@H](C)CN)c(OC)c1OC |
| InChI | InChI=1S/C13H22N2O3/c1-9(7-14)15-8-10-5-6-11(16-2)13(18-4)12(10)17-3/h5-6,9,15H,7-8,14H2,1-4H3/t9-/m0/s1 |
| InChIKey | XMGNJZQVBLQUHQ-VIFPVBQESA-N |
| XLogP | 1.15 |
| TPSA | 65.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.33 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |