About 4-[(3,4-dimethoxy-2-nitrophenyl)methoxy]butyl-trimethoxysilane
4-[(3,4-dimethoxy-2-nitrophenyl)methoxy]butyl-trimethoxysilane (PubChem CID 89253844) has the molecular formula C16H27NO8Si
and a molecular weight of 389.48 g/mol. Its IUPAC name is 4-[(3,4-dimethoxy-2-nitrophenyl)methoxy]butyl-trimethoxysilane.
Molecular Properties
| Compound Name | 4-[(3,4-dimethoxy-2-nitrophenyl)methoxy]butyl-trimethoxysilane |
| PubChem CID | 89253844 |
| Molecular Formula | C16H27NO8Si |
| Molecular Weight | 389.48 g/mol |
| Exact Mass | 389.15 |
| IUPAC Name | 4-[(3,4-dimethoxy-2-nitrophenyl)methoxy]butyl-trimethoxysilane |
| SMILES | COc1ccc(COCCCC[Si](OC)(OC)OC)c([N+](=O)[O-])c1OC |
| InChI | InChI=1S/C16H27NO8Si/c1-20-14-9-8-13(15(17(18)19)16(14)21-2)12-25-10-6-7-11-26(22-3,23-4)24-5/h8-9H,6-7,10-12H2,1-5H3 |
| InChIKey | ZUSHOCFLTLJORR-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 98.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 389.48 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-[(3,4-dimethoxy-2-nitrophenyl)methoxy]butyl-trimethoxysilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(3,4-dimethoxy-2-nitrophenyl)methoxy]butyl-trimethoxysilane?
The IUPAC name of 4-[(3,4-dimethoxy-2-nitrophenyl)methoxy]butyl-trimethoxysilane (CID 89253844) is 4-[(3,4-dimethoxy-2-nitrophenyl)methoxy]butyl-trimethoxysilane.
What is the SMILES notation for 4-[(3,4-dimethoxy-2-nitrophenyl)methoxy]butyl-trimethoxysilane?
The canonical SMILES for 4-[(3,4-dimethoxy-2-nitrophenyl)methoxy]butyl-trimethoxysilane is COc1ccc(COCCCC[Si](OC)(OC)OC)c([N+](=O)[O-])c1OC.
What is the InChIKey of 4-[(3,4-dimethoxy-2-nitrophenyl)methoxy]butyl-trimethoxysilane?
The InChIKey is ZUSHOCFLTLJORR-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H27NO8Si/c1-20-14-9-8-13(15(17(18)19)16(14)21-2)12-25-10-6-7-11-26(22-3,23-4)24-5/h8-9H,6-7,10-12H2,1-5H3.
What are the key properties of 4-[(3,4-dimethoxy-2-nitrophenyl)methoxy]butyl-trimethoxysilane?
4-[(3,4-dimethoxy-2-nitrophenyl)methoxy]butyl-trimethoxysilane has a molecular weight of 389.48 g/mol, XLogP of 2.79, 13 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(3,4-dimethoxy-2-nitrophenyl)methoxy]butyl-trimethoxysilane is sourced from PubChem (CID 89253844), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).