C16H27NO8Si — CID 89253844
4-[(3,4-dimethoxy-2-nitrophenyl)methoxy]butyl-trimethoxysilane (PubChem CID 89253844) has the molecular formula C16H27NO8Si and a molecular weight of 389.48 g/mol. Its IUPAC name is 4-[(3,4-dimethoxy-2-nitrophenyl)methoxy]butyl-trimethoxysilane.
| Compound Name | 4-[(3,4-dimethoxy-2-nitrophenyl)methoxy]butyl-trimethoxysilane |
|---|---|
| PubChem CID | 89253844 |
| Molecular Formula | C16H27NO8Si |
| Molecular Weight | 389.48 g/mol |
| Exact Mass | 389.15 |
| IUPAC Name | 4-[(3,4-dimethoxy-2-nitrophenyl)methoxy]butyl-trimethoxysilane |
| SMILES | COc1ccc(COCCCC[Si](OC)(OC)OC)c([N+](=O)[O-])c1OC |
| InChI | InChI=1S/C16H27NO8Si/c1-20-14-9-8-13(15(17(18)19)16(14)21-2)12-25-10-6-7-11-26(22-3,23-4)24-5/h8-9H,6-7,10-12H2,1-5H3 |
| InChIKey | ZUSHOCFLTLJORR-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 98.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.48 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|