C18H31NO9Si — CID 58722747
4-[(4-ethoxy-2,3-dimethoxy-6-nitrophenyl)methoxy]butyl-trimethoxysilane (PubChem CID 58722747) has the molecular formula C18H31NO9Si and a molecular weight of 433.53 g/mol. Its IUPAC name is 4-[(4-ethoxy-2,3-dimethoxy-6-nitrophenyl)methoxy]butyl-trimethoxysilane.
| Compound Name | 4-[(4-ethoxy-2,3-dimethoxy-6-nitrophenyl)methoxy]butyl-trimethoxysilane |
|---|---|
| PubChem CID | 58722747 |
| Molecular Formula | C18H31NO9Si |
| Molecular Weight | 433.53 g/mol |
| Exact Mass | 433.18 |
| IUPAC Name | 4-[(4-ethoxy-2,3-dimethoxy-6-nitrophenyl)methoxy]butyl-trimethoxysilane |
| SMILES | CCOc1cc([N+](=O)[O-])c(COCCCC[Si](OC)(OC)OC)c(OC)c1OC |
| InChI | InChI=1S/C18H31NO9Si/c1-7-28-16-12-15(19(20)21)14(17(22-2)18(16)23-3)13-27-10-8-9-11-29(24-4,25-5)26-6/h12H,7-11,13H2,1-6H3 |
| InChIKey | ZUHTZWQUMOJSNX-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 107.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.53 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|