C17H29N2O7RfSi- — CID 89253894
N-ethyl-2-methoxy-5-nitro-4-(4-trimethoxysilylbutoxymethyl)aniline;rutherfordium (PubChem CID 89253894) has the molecular formula C17H29N2O7RfSi- and a molecular weight of 668.51 g/mol. Its IUPAC name is N-ethyl-2-methoxy-5-nitro-4-(4-trimethoxysilylbutoxymethyl)aniline;rutherfordium.
| Compound Name | N-ethyl-2-methoxy-5-nitro-4-(4-trimethoxysilylbutoxymethyl)aniline;rutherfordium |
|---|---|
| PubChem CID | 89253894 |
| Molecular Formula | C17H29N2O7RfSi- |
| Molecular Weight | 668.51 g/mol |
| Exact Mass | 668.30 |
| IUPAC Name | N-ethyl-2-methoxy-5-nitro-4-(4-trimethoxysilylbutoxymethyl)aniline;rutherfordium |
| SMILES | [CH2-]CNc1cc([N+](=O)[O-])c(COCCCC[Si](OC)(OC)OC)cc1OC.[Rf] |
| InChI | InChI=1S/C17H29N2O7Si.Rf/c1-6-18-15-12-16(19(20)21)14(11-17(15)22-2)13-26-9-7-8-10-27(23-3,24-4)25-5;/h11-12,18H,1,6-10,13H2,2-5H3;/q-1; |
| InChIKey | DXHDVRVUCLHSGD-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 101.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 668.51 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|