C16H25N2O8RfSi- — CID 89253867
[2-methoxy-5-nitro-4-(4-trimethoxysilylbutoxymethyl)anilino]methanone;rutherfordium (PubChem CID 89253867) has the molecular formula C16H25N2O8RfSi- and a molecular weight of 668.47 g/mol. Its IUPAC name is [2-methoxy-5-nitro-4-(4-trimethoxysilylbutoxymethyl)anilino]methanone;rutherfordium.
| Compound Name | [2-methoxy-5-nitro-4-(4-trimethoxysilylbutoxymethyl)anilino]methanone;rutherfordium |
|---|---|
| PubChem CID | 89253867 |
| Molecular Formula | C16H25N2O8RfSi- |
| Molecular Weight | 668.47 g/mol |
| Exact Mass | 668.26 |
| IUPAC Name | [2-methoxy-5-nitro-4-(4-trimethoxysilylbutoxymethyl)anilino]methanone;rutherfordium |
| SMILES | COc1cc(COCCCC[Si](OC)(OC)OC)c([N+](=O)[O-])cc1N[C-]=O.[Rf] |
| InChI | InChI=1S/C16H25N2O8Si.Rf/c1-22-16-9-13(15(18(20)21)10-14(16)17-12-19)11-26-7-5-6-8-27(23-2,24-3)25-4;/h9-10H,5-8,11H2,1-4H3,(H,17,19);/q-1; |
| InChIKey | SKLFWNCVLNFCNF-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 118.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 668.47 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|