C20H28O6Si — CID 175436947
bis(2,3-dimethoxyphenyl)-diethoxysilane (PubChem CID 175436947) has the molecular formula C20H28O6Si and a molecular weight of 392.52 g/mol. Its IUPAC name is bis(2,3-dimethoxyphenyl)-diethoxysilane.
| Compound Name | bis(2,3-dimethoxyphenyl)-diethoxysilane |
|---|---|
| PubChem CID | 175436947 |
| Molecular Formula | C20H28O6Si |
| Molecular Weight | 392.52 g/mol |
| Exact Mass | 392.17 |
| IUPAC Name | bis(2,3-dimethoxyphenyl)-diethoxysilane |
| SMILES | CCO[Si](OCC)(c1cccc(OC)c1OC)c1cccc(OC)c1OC |
| InChI | InChI=1S/C20H28O6Si/c1-7-25-27(26-8-2,17-13-9-11-15(21-3)19(17)23-5)18-14-10-12-16(22-4)20(18)24-6/h9-14H,7-8H2,1-6H3 |
| InChIKey | DKJVQCTVAXWORK-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.52 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|