C16H28O5Si — CID 90120995
2-(2,3-dimethoxyphenyl)ethyl-triethoxysilane (PubChem CID 90120995) has the molecular formula C16H28O5Si and a molecular weight of 328.48 g/mol. Its IUPAC name is 2-(2,3-dimethoxyphenyl)ethyl-triethoxysilane.
| Compound Name | 2-(2,3-dimethoxyphenyl)ethyl-triethoxysilane |
|---|---|
| PubChem CID | 90120995 |
| Molecular Formula | C16H28O5Si |
| Molecular Weight | 328.48 g/mol |
| Exact Mass | 328.17 |
| IUPAC Name | 2-(2,3-dimethoxyphenyl)ethyl-triethoxysilane |
| SMILES | CCO[Si](CCc1cccc(OC)c1OC)(OCC)OCC |
| InChI | InChI=1S/C16H28O5Si/c1-6-19-22(20-7-2,21-8-3)13-12-14-10-9-11-15(17-4)16(14)18-5/h9-11H,6-8,12-13H2,1-5H3 |
| InChIKey | IWCOXFSPHPLTPZ-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.48 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|