C29H40O3P2Si — CID 11181263
diphenyl-[3-[phenyl(2-triethoxysilylethyl)phosphanyl]propyl]phosphane (PubChem CID 11181263) has the molecular formula C29H40O3P2Si and a molecular weight of 526.67 g/mol. Its IUPAC name is diphenyl-[3-[phenyl(2-triethoxysilylethyl)phosphanyl]propyl]phosphane.
| Compound Name | diphenyl-[3-[phenyl(2-triethoxysilylethyl)phosphanyl]propyl]phosphane |
|---|---|
| PubChem CID | 11181263 |
| Molecular Formula | C29H40O3P2Si |
| Molecular Weight | 526.67 g/mol |
| Exact Mass | 526.22 |
| IUPAC Name | diphenyl-[3-[phenyl(2-triethoxysilylethyl)phosphanyl]propyl]phosphane |
| SMILES | CCO[Si](CCP(CCCP(c1ccccc1)c1ccccc1)c1ccccc1)(OCC)OCC |
| InChI | InChI=1S/C29H40O3P2Si/c1-4-30-35(31-5-2,32-6-3)26-25-33(27-17-10-7-11-18-27)23-16-24-34(28-19-12-8-13-20-28)29-21-14-9-15-22-29/h7-15,17-22H,4-6,16,23-26H2,1-3H3 |
| InChIKey | IBYOGCXJUXPBJA-UHFFFAOYSA-N |
| XLogP | 6.37 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.67 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|