C35H59O7PSi2 — CID 160966529
diphenyl(3-triethoxysilylpropyl)phosphane;triethoxy-[2-(7-oxabicyclo[4.1.0]heptan-3-yl)ethyl]silane (PubChem CID 160966529) has the molecular formula C35H59O7PSi2 and a molecular weight of 679.00 g/mol. Its IUPAC name is diphenyl(3-triethoxysilylpropyl)phosphane;triethoxy-[2-(7-oxabicyclo[4.1.0]heptan-3-yl)ethyl]silane.
| Compound Name | diphenyl(3-triethoxysilylpropyl)phosphane;triethoxy-[2-(7-oxabicyclo[4.1.0]heptan-3-yl)ethyl]silane |
|---|---|
| PubChem CID | 160966529 |
| Molecular Formula | C35H59O7PSi2 |
| Molecular Weight | 679.00 g/mol |
| Exact Mass | 678.35 |
| IUPAC Name | diphenyl(3-triethoxysilylpropyl)phosphane;triethoxy-[2-(7-oxabicyclo[4.1.0]heptan-3-yl)ethyl]silane |
| SMILES | CCO[Si](CCC1CCC2OC2C1)(OCC)OCC.CCO[Si](CCCP(c1ccccc1)c1ccccc1)(OCC)OCC |
| InChI | InChI=1S/C21H31O3PSi.C14H28O4Si/c1-4-22-26(23-5-2,24-6-3)19-13-18-25(20-14-9-7-10-15-20)21-16-11-8-12-17-21;1-4-15-19(16-5-2,17-6-3)10-9-12-7-8-13-14(11-12)18-13/h7-12,14-17H,4-6,13,18-19H2,1-3H3;12-14H,4-11H2,1-3H3 |
| InChIKey | SXRUGOFUONJEDW-UHFFFAOYSA-N |
| XLogP | 7.55 |
| TPSA | 67.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 679.00 |
| LogP ≤ 5 | 7.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|