C20H36O7Si2 — CID 160925202
trimethoxy-[2-(7-oxabicyclo[4.1.0]heptan-3-yl)ethyl]silane;trimethoxy(phenyl)silane (PubChem CID 160925202) has the molecular formula C20H36O7Si2 and a molecular weight of 444.67 g/mol. Its IUPAC name is trimethoxy-[2-(7-oxabicyclo[4.1.0]heptan-3-yl)ethyl]silane;trimethoxy(phenyl)silane.
| Compound Name | trimethoxy-[2-(7-oxabicyclo[4.1.0]heptan-3-yl)ethyl]silane;trimethoxy(phenyl)silane |
|---|---|
| PubChem CID | 160925202 |
| Molecular Formula | C20H36O7Si2 |
| Molecular Weight | 444.67 g/mol |
| Exact Mass | 444.20 |
| IUPAC Name | trimethoxy-[2-(7-oxabicyclo[4.1.0]heptan-3-yl)ethyl]silane;trimethoxy(phenyl)silane |
| SMILES | CO[Si](CCC1CCC2OC2C1)(OC)OC.CO[Si](OC)(OC)c1ccccc1 |
| InChI | InChI=1S/C11H22O4Si.C9H14O3Si/c1-12-16(13-2,14-3)7-6-9-4-5-10-11(8-9)15-10;1-10-13(11-2,12-3)9-7-5-4-6-8-9/h9-11H,4-8H2,1-3H3;4-8H,1-3H3 |
| InChIKey | SSNVOIBILADPBJ-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 67.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.67 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|