C17H38O7SSi2 — CID 18692870
trimethoxy-[2-(7-oxabicyclo[4.1.0]heptan-3-yl)ethyl]silane;3-trimethoxysilylpropane-1-thiol (PubChem CID 18692870) has the molecular formula C17H38O7SSi2 and a molecular weight of 442.72 g/mol. Its IUPAC name is trimethoxy-[2-(7-oxabicyclo[4.1.0]heptan-3-yl)ethyl]silane;3-trimethoxysilylpropane-1-thiol.
| Compound Name | trimethoxy-[2-(7-oxabicyclo[4.1.0]heptan-3-yl)ethyl]silane;3-trimethoxysilylpropane-1-thiol |
|---|---|
| PubChem CID | 18692870 |
| Molecular Formula | C17H38O7SSi2 |
| Molecular Weight | 442.72 g/mol |
| Exact Mass | 442.19 |
| IUPAC Name | trimethoxy-[2-(7-oxabicyclo[4.1.0]heptan-3-yl)ethyl]silane;3-trimethoxysilylpropane-1-thiol |
| SMILES | CO[Si](CCC1CCC2OC2C1)(OC)OC.CO[Si](CCCS)(OC)OC |
| InChI | InChI=1S/C11H22O4Si.C6H16O3SSi/c1-12-16(13-2,14-3)7-6-9-4-5-10-11(8-9)15-10;1-7-11(8-2,9-3)6-4-5-10/h9-11H,4-8H2,1-3H3;10H,4-6H2,1-3H3 |
| InChIKey | CLGRGYIWVRFJKN-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 67.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.72 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|