About trimethoxy-[2-(7-oxabicyclo[4.1.0]heptan-3-yl)ethyl]silane;3-trimethoxysilylpropane-1-thiol
trimethoxy-[2-(7-oxabicyclo[4.1.0]heptan-3-yl)ethyl]silane;3-trimethoxysilylpropane-1-thiol (PubChem CID 18692870) has the molecular formula C17H38O7SSi2
and a molecular weight of 442.72 g/mol. Its IUPAC name is trimethoxy-[2-(7-oxabicyclo[4.1.0]heptan-3-yl)ethyl]silane;3-trimethoxysilylpropane-1-thiol.
Molecular Properties
| Compound Name | trimethoxy-[2-(7-oxabicyclo[4.1.0]heptan-3-yl)ethyl]silane;3-trimethoxysilylpropane-1-thiol |
| PubChem CID | 18692870 |
| Molecular Formula | C17H38O7SSi2 |
| Molecular Weight | 442.72 g/mol |
| Exact Mass | 442.19 |
| IUPAC Name | trimethoxy-[2-(7-oxabicyclo[4.1.0]heptan-3-yl)ethyl]silane;3-trimethoxysilylpropane-1-thiol |
| SMILES | CO[Si](CCC1CCC2OC2C1)(OC)OC.CO[Si](CCCS)(OC)OC |
| InChI | InChI=1S/C11H22O4Si.C6H16O3SSi/c1-12-16(13-2,14-3)7-6-9-4-5-10-11(8-9)15-10;1-7-11(8-2,9-3)6-4-5-10/h9-11H,4-8H2,1-3H3;10H,4-6H2,1-3H3 |
| InChIKey | CLGRGYIWVRFJKN-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 67.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 442.72 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze trimethoxy-[2-(7-oxabicyclo[4.1.0]heptan-3-yl)ethyl]silane;3-trimethoxysilylpropane-1-thiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trimethoxy-[2-(7-oxabicyclo[4.1.0]heptan-3-yl)ethyl]silane;3-trimethoxysilylpropane-1-thiol?
The IUPAC name of trimethoxy-[2-(7-oxabicyclo[4.1.0]heptan-3-yl)ethyl]silane;3-trimethoxysilylpropane-1-thiol (CID 18692870) is trimethoxy-[2-(7-oxabicyclo[4.1.0]heptan-3-yl)ethyl]silane;3-trimethoxysilylpropane-1-thiol.
What is the SMILES notation for trimethoxy-[2-(7-oxabicyclo[4.1.0]heptan-3-yl)ethyl]silane;3-trimethoxysilylpropane-1-thiol?
The canonical SMILES for trimethoxy-[2-(7-oxabicyclo[4.1.0]heptan-3-yl)ethyl]silane;3-trimethoxysilylpropane-1-thiol is CO[Si](CCC1CCC2OC2C1)(OC)OC.CO[Si](CCCS)(OC)OC.
What is the InChIKey of trimethoxy-[2-(7-oxabicyclo[4.1.0]heptan-3-yl)ethyl]silane;3-trimethoxysilylpropane-1-thiol?
The InChIKey is CLGRGYIWVRFJKN-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H22O4Si.C6H16O3SSi/c1-12-16(13-2,14-3)7-6-9-4-5-10-11(8-9)15-10;1-7-11(8-2,9-3)6-4-5-10/h9-11H,4-8H2,1-3H3;10H,4-6H2,1-3H3.
What are the key properties of trimethoxy-[2-(7-oxabicyclo[4.1.0]heptan-3-yl)ethyl]silane;3-trimethoxysilylpropane-1-thiol?
trimethoxy-[2-(7-oxabicyclo[4.1.0]heptan-3-yl)ethyl]silane;3-trimethoxysilylpropane-1-thiol has a molecular weight of 442.72 g/mol, XLogP of 3.01, 12 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for trimethoxy-[2-(7-oxabicyclo[4.1.0]heptan-3-yl)ethyl]silane;3-trimethoxysilylpropane-1-thiol is sourced from PubChem (CID 18692870), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).