C19H44O6Si4 — CID 101151102
[dimethyl-[2-(7-oxabicyclo[4.1.0]heptan-3-yl)ethyl]silyl]oxy-[dimethyl(2-trimethoxysilylethyl)silyl]oxy-dimethylsilane (PubChem CID 101151102) has the molecular formula C19H44O6Si4 and a molecular weight of 480.90 g/mol. Its IUPAC name is [dimethyl-[2-(7-oxabicyclo[4.1.0]heptan-3-yl)ethyl]silyl]oxy-[dimethyl(2-trimethoxysilylethyl)silyl]oxy-dimethylsilane.
| Compound Name | [dimethyl-[2-(7-oxabicyclo[4.1.0]heptan-3-yl)ethyl]silyl]oxy-[dimethyl(2-trimethoxysilylethyl)silyl]oxy-dimethylsilane |
|---|---|
| PubChem CID | 101151102 |
| Molecular Formula | C19H44O6Si4 |
| Molecular Weight | 480.90 g/mol |
| Exact Mass | 480.22 |
| IUPAC Name | [dimethyl-[2-(7-oxabicyclo[4.1.0]heptan-3-yl)ethyl]silyl]oxy-[dimethyl(2-trimethoxysilylethyl)silyl]oxy-dimethylsilane |
| SMILES | CO[Si](CC[Si](C)(C)O[Si](C)(C)O[Si](C)(C)CCC1CCC2OC2C1)(OC)OC |
| InChI | InChI=1S/C19H44O6Si4/c1-20-29(21-2,22-3)15-14-27(6,7)25-28(8,9)24-26(4,5)13-12-17-10-11-18-19(16-17)23-18/h17-19H,10-16H2,1-9H3 |
| InChIKey | MYVKCDBLOQNVCZ-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 58.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.90 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|